C18H16N4O5 — CID 102471751
ethyl 3-(2-acetyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)-2-diazo-3-oxopropanoate (PubChem CID 102471751) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is ethyl 3-(2-acetyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)-2-diazo-3-oxopropanoate.
| Compound Name | ethyl 3-(2-acetyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)-2-diazo-3-oxopropanoate |
|---|---|
| PubChem CID | 102471751 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | ethyl 3-(2-acetyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)-2-diazo-3-oxopropanoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)n1c2c(c3ccccc31)CCN(C(C)=O)C2=O |
| InChI | InChI=1S/C18H16N4O5/c1-3-27-18(26)14(20-19)16(24)22-13-7-5-4-6-11(13)12-8-9-21(10(2)23)17(25)15(12)22/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | MJAVBZPDWYXCHE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|