C23H24N4O5 — CID 74333898
ethyl 2-diazo-3-[2-(2-ethylpent-4-enoyl)-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl]-3-oxopropanoate (PubChem CID 74333898) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is ethyl 2-diazo-3-[2-(2-ethylpent-4-enoyl)-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl]-3-oxopropanoate.
| Compound Name | ethyl 2-diazo-3-[2-(2-ethylpent-4-enoyl)-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 74333898 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | ethyl 2-diazo-3-[2-(2-ethylpent-4-enoyl)-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl]-3-oxopropanoate |
| SMILES | C=CCC(CC)C(=O)N1CCc2c(n(C(=O)C(=[N+]=[N-])C(=O)OCC)c3ccccc23)C1=O |
| InChI | InChI=1S/C23H24N4O5/c1-4-9-14(5-2)20(28)26-13-12-16-15-10-7-8-11-17(15)27(19(16)22(26)30)21(29)18(25-24)23(31)32-6-3/h4,7-8,10-11,14H,1,5-6,9,12-13H2,2-3H3 |
| InChIKey | FUWAJWJWPOHZON-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|