C21H31FN2O2S — CID 145093366
2-[(4S)-4-(diethylcarbamoyl)-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl thiohypofluorite;methoxymethane (PubChem CID 145093366) has the molecular formula C21H31FN2O2S and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[(4S)-4-(diethylcarbamoyl)-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl thiohypofluorite;methoxymethane.
| Compound Name | 2-[(4S)-4-(diethylcarbamoyl)-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl thiohypofluorite;methoxymethane |
|---|---|
| PubChem CID | 145093366 |
| Molecular Formula | C21H31FN2O2S |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[(4S)-4-(diethylcarbamoyl)-1,2,3,4-tetrahydrocarbazol-9-yl]ethyl thiohypofluorite;methoxymethane |
| SMILES | CCN(CC)C(=O)[C@H]1CCCc2c1c1ccccc1n2CCSF.COC |
| InChI | InChI=1S/C19H25FN2OS.C2H6O/c1-3-21(4-2)19(23)15-9-7-11-17-18(15)14-8-5-6-10-16(14)22(17)12-13-24-20;1-3-2/h5-6,8,10,15H,3-4,7,9,11-13H2,1-2H3;1-2H3/t15-;/m0./s1 |
| InChIKey | KACUNLGOZUAHNL-RSAXXLAASA-N |
| XLogP | 4.81 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|