C20H22N2O5 — CID 122368129
methyl (5R,8S)-5-ethyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate (PubChem CID 122368129) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl (5R,8S)-5-ethyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate.
| Compound Name | methyl (5R,8S)-5-ethyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 122368129 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl (5R,8S)-5-ethyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate |
| SMILES | CC[C@]12CCC(=O)n3c1c(c1ccccc13)[C@@](NOC)(C(=O)OC)C(=O)C2 |
| InChI | InChI=1S/C20H22N2O5/c1-4-19-10-9-15(24)22-13-8-6-5-7-12(13)16(17(19)22)20(21-27-3,14(23)11-19)18(25)26-2/h5-8,21H,4,9-11H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | GCZRXFSBSUZZNE-WOJBJXKFSA-N |
| XLogP | 2.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|