C21H20O4 — CID 102099332
dimethyl tetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaene-1,8-dicarboxylate (PubChem CID 102099332) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is dimethyl tetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaene-1,8-dicarboxylate.
| Compound Name | dimethyl tetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 102099332 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | dimethyl tetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaene-1,8-dicarboxylate |
| SMILES | COC(=O)C12CCCC(C(=O)OC)(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C21H20O4/c1-24-18(22)20-12-7-13-21(19(23)25-2,16-10-5-3-8-14(16)20)17-11-6-4-9-15(17)20/h3-6,8-11H,7,12-13H2,1-2H3 |
| InChIKey | ZFHJPUVKOPGSJI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |