methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate

C13H13NO3 — CID 116999937

IUPACmethyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate
SMILESCOC(=O)C1(c2nc3ccccc3o2)CCC1
InChIInChI=1S/C13H13NO3/c1-16-12(15)13(7-4-8-13)11-14-9-5-2-3-6-10(9)17-11/h2-3,5-6H,4,7-8H2,1H3
InChIKeyBLNJJFXJNSIOIO-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.42
Rot. Bonds2

About methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate

methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate (PubChem CID 116999937) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate
PubChem CID116999937
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Namemethyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate
SMILESCOC(=O)C1(c2nc3ccccc3o2)CCC1
InChIInChI=1S/C13H13NO3/c1-16-12(15)13(7-4-8-13)11-14-9-5-2-3-6-10(9)17-11/h2-3,5-6H,4,7-8H2,1H3
InChIKeyBLNJJFXJNSIOIO-UHFFFAOYSA-N
XLogP2.42
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate?
The IUPAC name of methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate (CID 116999937) is methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate.
What is the SMILES notation for methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate?
The canonical SMILES for methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate is COC(=O)C1(c2nc3ccccc3o2)CCC1.
What is the InChIKey of methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate?
The InChIKey is BLNJJFXJNSIOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-16-12(15)13(7-4-8-13)11-14-9-5-2-3-6-10(9)17-11/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate?
methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate has a molecular weight of 231.25 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1,3-benzoxazol-2-yl)cyclobutane-1-carboxylate is sourced from PubChem (CID 116999937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).