C14H16BrNO3 — CID 115184298
methyl 1-[(2-bromophenyl)methylcarbamoyl]cyclobutane-1-carboxylate (PubChem CID 115184298) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is methyl 1-[(2-bromophenyl)methylcarbamoyl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[(2-bromophenyl)methylcarbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 115184298 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | methyl 1-[(2-bromophenyl)methylcarbamoyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)NCc2ccccc2Br)CCC1 |
| InChI | InChI=1S/C14H16BrNO3/c1-19-13(18)14(7-4-8-14)12(17)16-9-10-5-2-3-6-11(10)15/h2-3,5-6H,4,7-9H2,1H3,(H,16,17) |
| InChIKey | APHLCXNDXYBIJB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|