C22H23NO3 — CID 2794370
3-heptyl-3-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione (PubChem CID 2794370) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-heptyl-3-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione.
| Compound Name | 3-heptyl-3-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
|---|---|
| PubChem CID | 2794370 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-heptyl-3-hydroxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
| SMILES | CCCCCCCC1(O)C(=O)c2cccc3c4ccccc4n(c23)C1=O |
| InChI | InChI=1S/C22H23NO3/c1-2-3-4-5-8-14-22(26)20(24)17-12-9-11-16-15-10-6-7-13-18(15)23(19(16)17)21(22)25/h6-7,9-13,26H,2-5,8,14H2,1H3 |
| InChIKey | RAWGGXZICOQLDI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|