C15H7Cl2NO2 — CID 2785533
3,3-dichloro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione (PubChem CID 2785533) has the molecular formula C15H7Cl2NO2 and a molecular weight of 304.13 g/mol. Its IUPAC name is 3,3-dichloro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione.
| Compound Name | 3,3-dichloro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
|---|---|
| PubChem CID | 2785533 |
| Molecular Formula | C15H7Cl2NO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 3,3-dichloro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
| SMILES | O=C1c2cccc3c4ccccc4n(c23)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C15H7Cl2NO2/c16-15(17)13(19)10-6-3-5-9-8-4-1-2-7-11(8)18(12(9)10)14(15)20/h1-7H |
| InChIKey | MNMZNNAWHMGHHJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|