C15H7N5O4 — CID 110272478
3-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione (PubChem CID 110272478) has the molecular formula C15H7N5O4 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione.
| Compound Name | 3-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
|---|---|
| PubChem CID | 110272478 |
| Molecular Formula | C15H7N5O4 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-azido-3-nitro-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
| SMILES | [N-]=[N+]=NC1([N+](=O)[O-])C(=O)c2cccc3c4ccccc4n(c23)C1=O |
| InChI | InChI=1S/C15H7N5O4/c16-18-17-15(20(23)24)13(21)10-6-3-5-9-8-4-1-2-7-11(8)19(12(9)10)14(15)22/h1-7H |
| InChIKey | ZAOSZNMEDNUSQA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 130.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|