C22H12N4O2 — CID 153304614
12-nitro-3,6,14-triazahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2,4,6,8(13),9,11,15,17,19,21(25),22-dodecaene (PubChem CID 153304614) has the molecular formula C22H12N4O2 and a molecular weight of 364.36 g/mol. Its IUPAC name is 12-nitro-3,6,14-triazahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2,4,6,8(13),9,11,15,17,19,21(25),22-dodecaene.
| Compound Name | 12-nitro-3,6,14-triazahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2,4,6,8(13),9,11,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 153304614 |
| Molecular Formula | C22H12N4O2 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 12-nitro-3,6,14-triazahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2,4,6,8(13),9,11,15,17,19,21(25),22-dodecaene |
| SMILES | O=[N+]([O-])c1cccc2c1-n1c3ccccc3c3cccc(c31)-c1nccnc1-2 |
| InChI | InChI=1S/C22H12N4O2/c27-26(28)18-10-4-8-16-20-19(23-11-12-24-20)15-7-3-6-14-13-5-1-2-9-17(13)25(21(14)15)22(16)18/h1-12H |
| InChIKey | JRHNHBVEAXJNGG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|