C24H14N2O2 — CID 121386080
5-nitro-14-azahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2(7),3,5,8,10,12,15,17,19,21(25),22-dodecaene (PubChem CID 121386080) has the molecular formula C24H14N2O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-nitro-14-azahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2(7),3,5,8,10,12,15,17,19,21(25),22-dodecaene.
| Compound Name | 5-nitro-14-azahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2(7),3,5,8,10,12,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 121386080 |
| Molecular Formula | C24H14N2O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-nitro-14-azahexacyclo[12.10.1.02,7.08,13.015,20.021,25]pentacosa-1(24),2(7),3,5,8,10,12,15,17,19,21(25),22-dodecaene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-c1ccccc1-n1c3ccccc3c3cccc-2c31 |
| InChI | InChI=1S/C24H14N2O2/c27-26(28)15-12-13-16-19-8-5-9-20-17-6-1-3-10-22(17)25(24(19)20)23-11-4-2-7-18(23)21(16)14-15/h1-14H |
| InChIKey | JWOGIYGLOWWIGY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|