C20H21NO3 — CID 12033042
1-benzyl-3-butyl-3-hydroxyquinoline-2,4-dione (PubChem CID 12033042) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-benzyl-3-butyl-3-hydroxyquinoline-2,4-dione.
| Compound Name | 1-benzyl-3-butyl-3-hydroxyquinoline-2,4-dione |
|---|---|
| PubChem CID | 12033042 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-benzyl-3-butyl-3-hydroxyquinoline-2,4-dione |
| SMILES | CCCCC1(O)C(=O)c2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H21NO3/c1-2-3-13-20(24)18(22)16-11-7-8-12-17(16)21(19(20)23)14-15-9-5-4-6-10-15/h4-12,24H,2-3,13-14H2,1H3 |
| InChIKey | SAEZPHVRXHPVHB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|