C19H18ClNO2 — CID 2780323
1-butyl-3-chloro-3-phenylquinoline-2,4-dione (PubChem CID 2780323) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-butyl-3-chloro-3-phenylquinoline-2,4-dione.
| Compound Name | 1-butyl-3-chloro-3-phenylquinoline-2,4-dione |
|---|---|
| PubChem CID | 2780323 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-butyl-3-chloro-3-phenylquinoline-2,4-dione |
| SMILES | CCCCN1C(=O)C(Cl)(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H18ClNO2/c1-2-3-13-21-16-12-8-7-11-15(16)17(22)19(20,18(21)23)14-9-5-4-6-10-14/h4-12H,2-3,13H2,1H3 |
| InChIKey | NZYAECGZQIFRAS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|