C14H16ClNO2 — CID 7003892
(3R)-1-butyl-3-chloro-3-methylquinoline-2,4-dione (PubChem CID 7003892) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is (3R)-1-butyl-3-chloro-3-methylquinoline-2,4-dione.
| Compound Name | (3R)-1-butyl-3-chloro-3-methylquinoline-2,4-dione |
|---|---|
| PubChem CID | 7003892 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (3R)-1-butyl-3-chloro-3-methylquinoline-2,4-dione |
| SMILES | CCCCN1C(=O)[C@](C)(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H16ClNO2/c1-3-4-9-16-11-8-6-5-7-10(11)12(17)14(2,15)13(16)18/h5-8H,3-4,9H2,1-2H3/t14-/m1/s1 |
| InChIKey | RNLSUJNFHAQNSI-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|