C15H18ClNO2 — CID 2786540
1-butyl-3-chloro-3-ethylquinoline-2,4-dione (PubChem CID 2786540) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-butyl-3-chloro-3-ethylquinoline-2,4-dione.
| Compound Name | 1-butyl-3-chloro-3-ethylquinoline-2,4-dione |
|---|---|
| PubChem CID | 2786540 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-butyl-3-chloro-3-ethylquinoline-2,4-dione |
| SMILES | CCCCN1C(=O)C(Cl)(CC)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H18ClNO2/c1-3-5-10-17-12-9-7-6-8-11(12)13(18)15(16,4-2)14(17)19/h6-9H,3-5,10H2,1-2H3 |
| InChIKey | YZZSOARJJPYYLQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|