C10H7Cl2NO2 — CID 2785054
3,3-dichloro-1-methylquinoline-2,4-dione (PubChem CID 2785054) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is 3,3-dichloro-1-methylquinoline-2,4-dione.
| Compound Name | 3,3-dichloro-1-methylquinoline-2,4-dione |
|---|---|
| PubChem CID | 2785054 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 3,3-dichloro-1-methylquinoline-2,4-dione |
| SMILES | CN1C(=O)C(Cl)(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H7Cl2NO2/c1-13-7-5-3-2-4-6(7)8(14)10(11,12)9(13)15/h2-5H,1H3 |
| InChIKey | CWHVPZVGWJBXIF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|