C40H37NO4P+ — CID 102381883
[2-(1-benzyl-3-butyl-2,4-dioxoquinolin-3-yl)oxy-2-oxoethyl]-triphenylphosphanium (PubChem CID 102381883) has the molecular formula C40H37NO4P+ and a molecular weight of 626.71 g/mol. Its IUPAC name is [2-(1-benzyl-3-butyl-2,4-dioxoquinolin-3-yl)oxy-2-oxoethyl]-triphenylphosphanium.
| Compound Name | [2-(1-benzyl-3-butyl-2,4-dioxoquinolin-3-yl)oxy-2-oxoethyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 102381883 |
| Molecular Formula | C40H37NO4P+ |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | [2-(1-benzyl-3-butyl-2,4-dioxoquinolin-3-yl)oxy-2-oxoethyl]-triphenylphosphanium |
| SMILES | CCCCC1(OC(=O)C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C40H37NO4P/c1-2-3-28-40(38(43)35-26-16-17-27-36(35)41(39(40)44)29-31-18-8-4-9-19-31)45-37(42)30-46(32-20-10-5-11-21-32,33-22-12-6-13-23-33)34-24-14-7-15-25-34/h4-27H,2-3,28-30H2,1H3/q+1 |
| InChIKey | HBJRIFTZBIVHMT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|