C20H22N2O — CID 53305183
(15S,19R)-15-ethyl-16-methylidene-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one (PubChem CID 53305183) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (15S,19R)-15-ethyl-16-methylidene-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one.
| Compound Name | (15S,19R)-15-ethyl-16-methylidene-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
|---|---|
| PubChem CID | 53305183 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (15S,19R)-15-ethyl-16-methylidene-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
| SMILES | C=C1C(=O)n2c3c(c4ccccc42)CCN2CCC[C@]1(CC)[C@H]32 |
| InChI | InChI=1S/C20H22N2O/c1-3-20-10-6-11-21-12-9-15-14-7-4-5-8-16(14)22(17(15)18(20)21)19(23)13(20)2/h4-5,7-8,18H,2-3,6,9-12H2,1H3/t18-,20-/m0/s1 |
| InChIKey | BYKPJQXMXVPGMZ-ICSRJNTNSA-N |
| XLogP | 3.94 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|