C19H23N3O — CID 11001371
(NZ)-N-[(15R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-ylidene]hydroxylamine (PubChem CID 11001371) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (NZ)-N-[(15R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(15R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 11001371 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (NZ)-N-[(15R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-ylidene]hydroxylamine |
| SMILES | CC[C@]12CCCN3CCc4c(n(c5ccccc45)C/C1=N\O)[C@@H]32 |
| InChI | InChI=1S/C19H23N3O/c1-2-19-9-5-10-21-11-8-14-13-6-3-4-7-15(13)22(12-16(19)20-23)17(14)18(19)21/h3-4,6-7,18,23H,2,5,8-12H2,1H3/b20-16+/t18-,19+/m1/s1 |
| InChIKey | ZDGCVKPERVTZOZ-XQPBFXKYSA-N |
| XLogP | 3.57 |
| TPSA | 40.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|