C19H18N2O2 — CID 90752239
1-benzyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-9-carboxylic acid (PubChem CID 90752239) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-benzyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-9-carboxylic acid.
| Compound Name | 1-benzyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-9-carboxylic acid |
|---|---|
| PubChem CID | 90752239 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-benzyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-9-carboxylic acid |
| SMILES | O=C(O)n1c2c(c3ccccc31)CCNC2Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c22-19(23)21-17-9-5-4-8-14(17)15-10-11-20-16(18(15)21)12-13-6-2-1-3-7-13/h1-9,16,20H,10-12H2,(H,22,23) |
| InChIKey | UNGFLXGHVJGOIG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |