C16H20N2O — CID 14845123
9-(methoxymethyl)-1-prop-2-enyl-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 14845123) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 9-(methoxymethyl)-1-prop-2-enyl-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-(methoxymethyl)-1-prop-2-enyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 14845123 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 9-(methoxymethyl)-1-prop-2-enyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | C=CCC1NCCc2c1n(COC)c1ccccc21 |
| InChI | InChI=1S/C16H20N2O/c1-3-6-14-16-13(9-10-17-14)12-7-4-5-8-15(12)18(16)11-19-2/h3-5,7-8,14,17H,1,6,9-11H2,2H3 |
| InChIKey | KTPKZVADENQIAF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|