C17H19N — CID 132510291
3,4-bis(prop-2-enyl)-2,3-dihydro-1H-cyclopenta[b]indole (PubChem CID 132510291) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 3,4-bis(prop-2-enyl)-2,3-dihydro-1H-cyclopenta[b]indole.
| Compound Name | 3,4-bis(prop-2-enyl)-2,3-dihydro-1H-cyclopenta[b]indole |
|---|---|
| PubChem CID | 132510291 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3,4-bis(prop-2-enyl)-2,3-dihydro-1H-cyclopenta[b]indole |
| SMILES | C=CCC1CCc2c1n(CC=C)c1ccccc21 |
| InChI | InChI=1S/C17H19N/c1-3-7-13-10-11-15-14-8-5-6-9-16(14)18(12-4-2)17(13)15/h3-6,8-9,13H,1-2,7,10-12H2 |
| InChIKey | XBJKCBKKZFOCSD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|