C13H14CrN2 — CID 11429221
[1,3-bis(prop-2-enyl)benzimidazol-2-ylidene]chromium (PubChem CID 11429221) has the molecular formula C13H14CrN2 and a molecular weight of 250.26 g/mol. Its IUPAC name is [1,3-bis(prop-2-enyl)benzimidazol-2-ylidene]chromium.
| Compound Name | [1,3-bis(prop-2-enyl)benzimidazol-2-ylidene]chromium |
|---|---|
| PubChem CID | 11429221 |
| Molecular Formula | C13H14CrN2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [1,3-bis(prop-2-enyl)benzimidazol-2-ylidene]chromium |
| SMILES | C=CCn1c(=[Cr])n(CC=C)c2ccccc21 |
| InChI | InChI=1S/C13H14N2.Cr/c1-3-9-14-11-15(10-4-2)13-8-6-5-7-12(13)14;/h3-8H,1-2,9-10H2; |
| InChIKey | OGCPKFWXHBAZIK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|