About 9-prop-2-enyl-3,4-dihydrocarbazole
9-prop-2-enyl-3,4-dihydrocarbazole (PubChem CID 163625647) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 9-prop-2-enyl-3,4-dihydrocarbazole.
Molecular Properties
| Compound Name | 9-prop-2-enyl-3,4-dihydrocarbazole |
| PubChem CID | 163625647 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 9-prop-2-enyl-3,4-dihydrocarbazole |
| SMILES | C=CCn1c2c(c3ccccc31)CCC=C2 |
| InChI | InChI=1S/C15H15N/c1-2-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h2-3,5-7,9-10H,1,4,8,11H2 |
| InChIKey | HRUDISHREMMVAU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-prop-2-enyl-3,4-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-prop-2-enyl-3,4-dihydrocarbazole?
The IUPAC name of 9-prop-2-enyl-3,4-dihydrocarbazole (CID 163625647) is 9-prop-2-enyl-3,4-dihydrocarbazole.
What is the SMILES notation for 9-prop-2-enyl-3,4-dihydrocarbazole?
The canonical SMILES for 9-prop-2-enyl-3,4-dihydrocarbazole is C=CCn1c2c(c3ccccc31)CCC=C2.
What is the InChIKey of 9-prop-2-enyl-3,4-dihydrocarbazole?
The InChIKey is HRUDISHREMMVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-2-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h2-3,5-7,9-10H,1,4,8,11H2.
What are the key properties of 9-prop-2-enyl-3,4-dihydrocarbazole?
9-prop-2-enyl-3,4-dihydrocarbazole has a molecular weight of 209.29 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-prop-2-enyl-3,4-dihydrocarbazole is sourced from PubChem (CID 163625647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).