C13H16N2O — CID 13481645
9-methoxy-1-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 13481645) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 9-methoxy-1-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-methoxy-1-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 13481645 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 9-methoxy-1-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | COn1c2c(c3ccccc31)CCNC2C |
| InChI | InChI=1S/C13H16N2O/c1-9-13-11(7-8-14-9)10-5-3-4-6-12(10)15(13)16-2/h3-6,9,14H,7-8H2,1-2H3 |
| InChIKey | GYNAFKXLHRMQAX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |