C30H44N2O4Si — CID 73055229
tert-butyl (2R,3Z,12bS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylidene-4-oxo-2,6,7,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate (PubChem CID 73055229) has the molecular formula C30H44N2O4Si and a molecular weight of 524.78 g/mol. Its IUPAC name is tert-butyl (2R,3Z,12bS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylidene-4-oxo-2,6,7,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate.
| Compound Name | tert-butyl (2R,3Z,12bS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylidene-4-oxo-2,6,7,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate |
|---|---|
| PubChem CID | 73055229 |
| Molecular Formula | C30H44N2O4Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | tert-butyl (2R,3Z,12bS)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylidene-4-oxo-2,6,7,12b-tetrahydro-1H-indolo[2,3-a]quinolizine-12-carboxylate |
| SMILES | C/C=C1\C(=O)N2CCc3c(n(C(=O)OC(C)(C)C)c4ccccc34)[C@@H]2C[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H44N2O4Si/c1-10-21-20(16-18-35-37(8,9)30(5,6)7)19-25-26-23(15-17-31(25)27(21)33)22-13-11-12-14-24(22)32(26)28(34)36-29(2,3)4/h10-14,20,25H,15-19H2,1-9H3/b21-10-/t20-,25-/m0/s1 |
| InChIKey | CBDZJWZPRFHNQU-GMJHQBOQSA-N |
| XLogP | 7.23 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|