C22H37N3O3Si — CID 58274799
tert-butyl (4E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydrazinylidene-2,3-dihydroquinoline-1-carboxylate (PubChem CID 58274799) has the molecular formula C22H37N3O3Si and a molecular weight of 419.64 g/mol. Its IUPAC name is tert-butyl (4E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydrazinylidene-2,3-dihydroquinoline-1-carboxylate.
| Compound Name | tert-butyl (4E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydrazinylidene-2,3-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 58274799 |
| Molecular Formula | C22H37N3O3Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | tert-butyl (4E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydrazinylidene-2,3-dihydroquinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCO[Si](C)(C)C(C)(C)C)/C(=N\N)c2ccccc21 |
| InChI | InChI=1S/C22H37N3O3Si/c1-21(2,3)28-20(26)25-15-16(13-14-27-29(7,8)22(4,5)6)19(24-23)17-11-9-10-12-18(17)25/h9-12,16H,13-15,23H2,1-8H3/b24-19+ |
| InChIKey | WXGPMVGECPPMQI-LYBHJNIJSA-N |
| XLogP | 5.13 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|