C15H17NO4 — CID 138963331
tert-butyl 4-oxospiro[2H-quinoline-3,2'-oxirane]-1-carboxylate (PubChem CID 138963331) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is tert-butyl 4-oxospiro[2H-quinoline-3,2'-oxirane]-1-carboxylate.
| Compound Name | tert-butyl 4-oxospiro[2H-quinoline-3,2'-oxirane]-1-carboxylate |
|---|---|
| PubChem CID | 138963331 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | tert-butyl 4-oxospiro[2H-quinoline-3,2'-oxirane]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CO2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H17NO4/c1-14(2,3)20-13(18)16-8-15(9-19-15)12(17)10-6-4-5-7-11(10)16/h4-7H,8-9H2,1-3H3 |
| InChIKey | CIBBCDAPZSOCPP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|