C30H36N2O5 — CID 134952927
10-O-tert-butyl 17-O-methyl (16R,18E)-18-methoxyimino-17,21-dimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaene-10,17-dicarboxylate (PubChem CID 134952927) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is 10-O-tert-butyl 17-O-methyl (16R,18E)-18-methoxyimino-17,21-dimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaene-10,17-dicarboxylate.
| Compound Name | 10-O-tert-butyl 17-O-methyl (16R,18E)-18-methoxyimino-17,21-dimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaene-10,17-dicarboxylate |
|---|---|
| PubChem CID | 134952927 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 10-O-tert-butyl 17-O-methyl (16R,18E)-18-methoxyimino-17,21-dimethyl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaene-10,17-dicarboxylate |
| SMILES | CO/N=C1\CCC2(C)c3cc4c5ccccc5n(C(=O)OC(C)(C)C)c4cc3CC[C@H]2C1(C)C(=O)OC |
| InChI | InChI=1S/C30H36N2O5/c1-28(2,3)37-27(34)32-22-11-9-8-10-19(22)20-17-21-18(16-23(20)32)12-13-24-29(21,4)15-14-25(31-36-7)30(24,5)26(33)35-6/h8-11,16-17,24H,12-15H2,1-7H3/b31-25+/t24-,29?,30?/m1/s1 |
| InChIKey | FWSYCYBYRULZLH-IKLNDMGWSA-N |
| XLogP | 6.37 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|