C27H36N2O4 — CID 70156849
[(6aS,10aS)-4,7-di(butanoyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl butanoate (PubChem CID 70156849) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is [(6aS,10aS)-4,7-di(butanoyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl butanoate.
| Compound Name | [(6aS,10aS)-4,7-di(butanoyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl butanoate |
|---|---|
| PubChem CID | 70156849 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | [(6aS,10aS)-4,7-di(butanoyl)-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl butanoate |
| SMILES | CCCC(=O)OCC1C[C@H]2c3cccc4c3c(cn4C(=O)CCC)C[C@@H]2N(C(=O)CCC)C1 |
| InChI | InChI=1S/C27H36N2O4/c1-4-8-24(30)28-15-18(17-33-26(32)10-6-3)13-21-20-11-7-12-22-27(20)19(14-23(21)28)16-29(22)25(31)9-5-2/h7,11-12,16,18,21,23H,4-6,8-10,13-15,17H2,1-3H3/t18?,21-,23-/m0/s1 |
| InChIKey | OCZMIIPRASSCTO-BUQVANKGSA-N |
| XLogP | 5.08 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |