C25H35N3O2 — CID 57019369
2-[(6aR,9S)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl azepane-2-carboxylate (PubChem CID 57019369) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-[(6aR,9S)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl azepane-2-carboxylate.
| Compound Name | 2-[(6aR,9S)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl azepane-2-carboxylate |
|---|---|
| PubChem CID | 57019369 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-[(6aR,9S)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl azepane-2-carboxylate |
| SMILES | CN1C[C@H](CCOC(=O)C2CCCCCN2)CC2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C25H35N3O2/c1-27-15-17(10-12-30-25(29)21-8-4-3-5-11-26-21)13-20-19-7-6-9-22-24(19)18(14-23(20)27)16-28(22)2/h6-7,9,16-17,20-21,23,26H,3-5,8,10-15H2,1-2H3/t17-,20?,21?,23-/m1/s1 |
| InChIKey | UZHBFSFHYJFERI-IWKILKBESA-N |
| XLogP | 3.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|