C24H33N3O3 — CID 57159282
2-[(6aR,10aR)-4,5,7-trimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate (PubChem CID 57159282) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[(6aR,10aR)-4,5,7-trimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate.
| Compound Name | 2-[(6aR,10aR)-4,5,7-trimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 57159282 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-[(6aR,10aR)-4,5,7-trimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]ethyl morpholine-4-carboxylate |
| SMILES | Cc1c2c3c(cccc3n1C)[C@H]1CC(CCOC(=O)N3CCOCC3)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C24H33N3O3/c1-16-19-14-22-20(18-5-4-6-21(23(18)19)26(16)3)13-17(15-25(22)2)7-10-30-24(28)27-8-11-29-12-9-27/h4-6,17,20,22H,7-15H2,1-3H3/t17?,20-,22-/m1/s1 |
| InChIKey | YIWVDQKSKFJSGY-SXHSKPAUSA-N |
| XLogP | 3.31 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|