C20H24BrN3O2 — CID 70591508
[(6aR,9R)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azetidine-1-carboxylate (PubChem CID 70591508) has the molecular formula C20H24BrN3O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is [(6aR,9R)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azetidine-1-carboxylate.
| Compound Name | [(6aR,9R)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azetidine-1-carboxylate |
|---|---|
| PubChem CID | 70591508 |
| Molecular Formula | C20H24BrN3O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [(6aR,9R)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azetidine-1-carboxylate |
| SMILES | CN1C[C@H](COC(=O)N2CCC2)CC2c3cccc4[nH]c(Br)c(c34)C[C@H]21 |
| InChI | InChI=1S/C20H24BrN3O2/c1-23-10-12(11-26-20(25)24-6-3-7-24)8-14-13-4-2-5-16-18(13)15(9-17(14)23)19(21)22-16/h2,4-5,12,14,17,22H,3,6-11H2,1H3/t12-,14?,17-/m1/s1 |
| InChIKey | AJVDHYSFPOBKPQ-ZYFOBHMOSA-N |
| XLogP | 3.73 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |