C17H21ClN2O3S — CID 88812486
[(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate (PubChem CID 88812486) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is [(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate.
| Compound Name | [(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88812486 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methanesulfonate |
| SMILES | CN1CC(COS(C)(=O)=O)C[C@H]2c3cccc4[nH]c(Cl)c(c34)C[C@@H]21 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-20-8-10(9-23-24(2,21)22)6-12-11-4-3-5-14-16(11)13(7-15(12)20)17(18)19-14/h3-5,10,12,15,19H,6-9H2,1-2H3/t10?,12-,15-/m0/s1 |
| InChIKey | OYASXKRMTVLBBB-QKHYJBKJSA-N |
| XLogP | 2.76 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|