C16H18BrClN2 — CID 54476679
(6aR)-9-(bromomethyl)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 54476679) has the molecular formula C16H18BrClN2 and a molecular weight of 353.69 g/mol. Its IUPAC name is (6aR)-9-(bromomethyl)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR)-9-(bromomethyl)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 54476679 |
| Molecular Formula | C16H18BrClN2 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (6aR)-9-(bromomethyl)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1CC(CBr)CC2c3cccc4[nH]c(Cl)c(c34)C[C@H]21 |
| InChI | InChI=1S/C16H18BrClN2/c1-20-8-9(7-17)5-11-10-3-2-4-13-15(10)12(6-14(11)20)16(18)19-13/h2-4,9,11,14,19H,5-8H2,1H3/t9?,11?,14-/m1/s1 |
| InChIKey | XMBMBHWUVUKJAP-PFMWSLTASA-N |
| XLogP | 4.18 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|