C20H28N2S2 — CID 70369595
(6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 70369595) has the molecular formula C20H28N2S2 and a molecular weight of 360.59 g/mol. Its IUPAC name is (6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 70369595 |
| Molecular Formula | C20H28N2S2 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (6aR,9R)-7-methyl-9-(methylsulfanylmethyl)-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CCCSc1[nH]c2cccc3c2c1C[C@@H]1C3C[C@@H](CSC)CN1C |
| InChI | InChI=1S/C20H28N2S2/c1-4-8-24-20-16-10-18-15(9-13(12-23-3)11-22(18)2)14-6-5-7-17(21-20)19(14)16/h5-7,13,15,18,21H,4,8-12H2,1-3H3/t13-,15?,18-/m1/s1 |
| InChIKey | RLYFDQHETAVBCB-JGNDPHQUSA-N |
| XLogP | 4.99 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |