C19H26N2S — CID 54060273
(6aR,9R)-7,9-dimethyl-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 54060273) has the molecular formula C19H26N2S and a molecular weight of 314.50 g/mol. Its IUPAC name is (6aR,9R)-7,9-dimethyl-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,9R)-7,9-dimethyl-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 54060273 |
| Molecular Formula | C19H26N2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (6aR,9R)-7,9-dimethyl-5-propylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CCCSc1[nH]c2cccc3c2c1C[C@@H]1C3C[C@@H](C)CN1C |
| InChI | InChI=1S/C19H26N2S/c1-4-8-22-19-15-10-17-14(9-12(2)11-21(17)3)13-6-5-7-16(20-19)18(13)15/h5-7,12,14,17,20H,4,8-11H2,1-3H3/t12-,14?,17-/m1/s1 |
| InChIKey | LZEYRHGOJCJFBD-ZYFOBHMOSA-N |
| XLogP | 4.65 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |