C24H33N3O2S — CID 57023993
[(6aR,9R)-7-methyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azepane-2-carboxylate (PubChem CID 57023993) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is [(6aR,9R)-7-methyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azepane-2-carboxylate.
| Compound Name | [(6aR,9R)-7-methyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azepane-2-carboxylate |
|---|---|
| PubChem CID | 57023993 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [(6aR,9R)-7-methyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl azepane-2-carboxylate |
| SMILES | CSc1[nH]c2cccc3c2c1C[C@@H]1C3C[C@@H](COC(=O)C2CCCCCN2)CN1C |
| InChI | InChI=1S/C24H33N3O2S/c1-27-13-15(14-29-24(28)20-8-4-3-5-10-25-20)11-17-16-7-6-9-19-22(16)18(12-21(17)27)23(26-19)30-2/h6-7,9,15,17,20-21,25-26H,3-5,8,10-14H2,1-2H3/t15-,17?,20?,21-/m1/s1 |
| InChIKey | COSBXSISAUNZRE-CFRTXYBOSA-N |
| XLogP | 3.93 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |