C25H33N3O6S — CID 70592841
[(6aR,9R)-4,7-dimethyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl N,N-dimethylcarbamate;(Z)-but-2-enedioic acid (PubChem CID 70592841) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is [(6aR,9R)-4,7-dimethyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl N,N-dimethylcarbamate;(Z)-but-2-enedioic acid.
| Compound Name | [(6aR,9R)-4,7-dimethyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl N,N-dimethylcarbamate;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70592841 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [(6aR,9R)-4,7-dimethyl-5-methylsulfanyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]methyl N,N-dimethylcarbamate;(Z)-but-2-enedioic acid |
| SMILES | CSc1c2c3c(cccc3n1C)C1C[C@@H](COC(=O)N(C)C)CN(C)[C@@H]1C2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H29N3O2S.C4H4O4/c1-22(2)21(25)26-12-13-9-15-14-7-6-8-17-19(14)16(20(27-5)24(17)4)10-18(15)23(3)11-13;5-3(6)1-2-4(7)8/h6-8,13,15,18H,9-12H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t13-,15?,18-;/m1./s1 |
| InChIKey | HTJSAALPHLMAQS-IHVXGIBTSA-N |
| XLogP | 3.27 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|