C18H21ClN2O3 — CID 70628113
[(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methyl carbonate (PubChem CID 70628113) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is [(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methyl carbonate.
| Compound Name | [(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 70628113 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(6aS,10aS)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl methyl carbonate |
| SMILES | COC(=O)OCC1C[C@H]2c3cccc4[nH]c(Cl)c(c34)C[C@@H]2N(C)C1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-21-8-10(9-24-18(22)23-2)6-12-11-4-3-5-14-16(11)13(7-15(12)21)17(19)20-14/h3-5,10,12,15,20H,6-9H2,1-2H3/t10?,12-,15-/m0/s1 |
| InChIKey | XMEKEDYWSBNEBG-QKHYJBKJSA-N |
| XLogP | 3.56 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |