C37H53ClN2O5 — CID 70578425
2-[(6aR,9S)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 70578425) has the molecular formula C37H53ClN2O5 and a molecular weight of 641.29 g/mol. Its IUPAC name is 2-[(6aR,9S)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | 2-[(6aR,9S)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70578425 |
| Molecular Formula | C37H53ClN2O5 |
| Molecular Weight | 641.29 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | 2-[(6aR,9S)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]ethyl 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OCC[C@@H]1CC2c3cccc4[nH]c(Cl)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C37H53ClN2O5/c1-3-4-7-11-25(41)16-17-27-26(33(42)22-34(27)43)12-8-5-6-9-15-35(44)45-19-18-24-20-29-28-13-10-14-31-36(28)30(37(38)39-31)21-32(29)40(2)23-24/h10,13-14,16-17,24-27,29,32,34,39,41,43H,3-9,11-12,15,18-23H2,1-2H3/t24-,25+,26-,27-,29?,32-,34-/m1/s1 |
| InChIKey | HXJJBMVUDWAOLU-CHNKNZANSA-N |
| XLogP | 7.12 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.29 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|