C20H24N4O2 — CID 70424433
1-[[(6aR,9R)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]imidazolidine-2,4-dione (PubChem CID 70424433) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[[(6aR,9R)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 1-[[(6aR,9R)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70424433 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[[(6aR,9R)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]imidazolidine-2,4-dione |
| SMILES | Cc1[nH]c2cccc3c2c1C[C@@H]1C3C[C@@H](CN2CC(=O)NC2=O)CN1C |
| InChI | InChI=1S/C20H24N4O2/c1-11-14-7-17-15(13-4-3-5-16(21-11)19(13)14)6-12(8-23(17)2)9-24-10-18(25)22-20(24)26/h3-5,12,15,17,21H,6-10H2,1-2H3,(H,22,25,26)/t12-,15?,17-/m1/s1 |
| InChIKey | YHSDGTDDNRDFQV-XURPUJGUSA-N |
| XLogP | 1.99 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|