C22H29BrN4O2 — CID 88784199
[[(6aS,10aS)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(4-methylpiperazin-1-yl)methyl] formate (PubChem CID 88784199) has the molecular formula C22H29BrN4O2 and a molecular weight of 461.40 g/mol. Its IUPAC name is [[(6aS,10aS)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(4-methylpiperazin-1-yl)methyl] formate.
| Compound Name | [[(6aS,10aS)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(4-methylpiperazin-1-yl)methyl] formate |
|---|---|
| PubChem CID | 88784199 |
| Molecular Formula | C22H29BrN4O2 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [[(6aS,10aS)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-(4-methylpiperazin-1-yl)methyl] formate |
| SMILES | CN1CCN(C(OC=O)C2C[C@H]3c4cccc5[nH]c(Br)c(c45)C[C@@H]3N(C)C2)CC1 |
| InChI | InChI=1S/C22H29BrN4O2/c1-25-6-8-27(9-7-25)22(29-13-28)14-10-16-15-4-3-5-18-20(15)17(21(23)24-18)11-19(16)26(2)12-14/h3-5,13-14,16,19,22,24H,6-12H2,1-2H3/t14?,16-,19-,22?/m0/s1 |
| InChIKey | FOYAFZHEACPEQZ-IYXTZDNXSA-N |
| XLogP | 2.64 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|