C16H17BrN2O5 — CID 70546403
10-bromo-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;oxalic acid (PubChem CID 70546403) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is 10-bromo-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;oxalic acid.
| Compound Name | 10-bromo-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;oxalic acid |
|---|---|
| PubChem CID | 70546403 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 10-bromo-6-methyl-3-oxa-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene;oxalic acid |
| SMILES | CN1CCOC2c3cccc4[nH]c(Br)c(c34)CC21.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H15BrN2O.C2H2O4/c1-17-5-6-18-13-8-3-2-4-10-12(8)9(7-11(13)17)14(15)16-10;3-1(4)2(5)6/h2-4,11,13,16H,5-7H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KISVIJFFQBRCCC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|