C17H19BrN2O — CID 70118962
[(6aR,9R)-5-bromo-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol (PubChem CID 70118962) has the molecular formula C17H19BrN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is [(6aR,9R)-5-bromo-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol.
| Compound Name | [(6aR,9R)-5-bromo-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol |
|---|---|
| PubChem CID | 70118962 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [(6aR,9R)-5-bromo-7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinolin-9-yl]methanol |
| SMILES | CN1C[C@](C)(CO)C=C2c3cccc4[nH]c(Br)c(c34)C[C@H]21 |
| InChI | InChI=1S/C17H19BrN2O/c1-17(9-21)7-12-10-4-3-5-13-15(10)11(16(18)19-13)6-14(12)20(2)8-17/h3-5,7,14,19,21H,6,8-9H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | WTMDMJXMGBYVGG-RHSMWYFYSA-N |
| XLogP | 3.18 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |