C21H26BrN3 — CID 167513632
1-[(9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N,N-diethylethenamine (PubChem CID 167513632) has the molecular formula C21H26BrN3 and a molecular weight of 400.36 g/mol. Its IUPAC name is 1-[(9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N,N-diethylethenamine.
| Compound Name | 1-[(9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N,N-diethylethenamine |
|---|---|
| PubChem CID | 167513632 |
| Molecular Formula | C21H26BrN3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[(9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N,N-diethylethenamine |
| SMILES | C=C([C@@H]1C=C2c3cccc4[nH]c(Br)c(c34)CC2N(C)C1)N(CC)CC |
| InChI | InChI=1S/C21H26BrN3/c1-5-25(6-2)13(3)14-10-16-15-8-7-9-18-20(15)17(21(22)23-18)11-19(16)24(4)12-14/h7-10,14,19,23H,3,5-6,11-12H2,1-2,4H3/t14-,19?/m1/s1 |
| InChIKey | DDPKGWQHQDSKOY-MJTSIZKDSA-N |
| XLogP | 4.66 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |