C18H20N2O2 — CID 22791373
(6aR,9R)-4,7,9-trimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxylic acid (PubChem CID 22791373) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (6aR,9R)-4,7,9-trimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxylic acid.
| Compound Name | (6aR,9R)-4,7,9-trimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 22791373 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (6aR,9R)-4,7,9-trimethyl-6a,8-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxylic acid |
| SMILES | CN1C[C@](C)(C(=O)O)C=C2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C18H20N2O2/c1-18(17(21)22)8-13-12-5-4-6-14-16(12)11(9-19(14)2)7-15(13)20(3)10-18/h4-6,8-9,15H,7,10H2,1-3H3,(H,21,22)/t15-,18-/m1/s1 |
| InChIKey | NLBVQNOAMRYJKH-CRAIPNDOSA-N |
| XLogP | 2.52 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|