C17H17BrN2O2 — CID 139604159
(6aR,9R)-5-bromo-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid (PubChem CID 139604159) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is (6aR,9R)-5-bromo-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid.
| Compound Name | (6aR,9R)-5-bromo-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 139604159 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (6aR,9R)-5-bromo-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid |
| SMILES | CN1C[C@H](C(=O)O)C=C2c3cccc4c3c(c(Br)n4C)C[C@H]21 |
| InChI | InChI=1S/C17H17BrN2O2/c1-19-8-9(17(21)22)6-11-10-4-3-5-13-15(10)12(7-14(11)19)16(18)20(13)2/h3-6,9,14H,7-8H2,1-2H3,(H,21,22)/t9-,14-/m1/s1 |
| InChIKey | IDSRPECAZVGBLV-YMTOWFKASA-N |
| XLogP | 2.90 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|