C17H17ClN2O — CID 88808028
(6aR,9R)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carbonyl chloride (PubChem CID 88808028) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is (6aR,9R)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carbonyl chloride.
| Compound Name | (6aR,9R)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carbonyl chloride |
|---|---|
| PubChem CID | 88808028 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (6aR,9R)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carbonyl chloride |
| SMILES | CN1C[C@H](C(=O)Cl)C=C2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C17H17ClN2O/c1-19-8-10-7-15-13(6-11(17(18)21)9-20(15)2)12-4-3-5-14(19)16(10)12/h3-6,8,11,15H,7,9H2,1-2H3/t11-,15-/m1/s1 |
| InChIKey | YGBAWIYCYGNGJD-IAQYHMDHSA-N |
| XLogP | 2.81 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|